4-heptyloxybenzoic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

4-(heptyloxy)benzoic acid; 4-heptyloxybenzoic acid; 4-n-heptyloxybenzoic acid
CAS RN:[15872-42-1]
Formula:C14H20O3; 236.31 g/mol
InChiKey:ZRVIYEJYXIDATJ-UHFFFAOYSA-N
SMILES:CCCCCCCOc1ccc(cc1)C(O)=O
Molecular structure of 4-heptyloxybenzoic acid
Melting point:93 °C

Isomers

2-(4-tert-butylphenoxy)ethyl acetate
Molecular structure of 2-(4-tert-butylphenoxy)ethyl acetate
ethyl 2-(2,4-dimethylphenoxy)-2-methylpropanoate
Molecular structure of ethyl 2-(2,4-dimethylphenoxy)-2-methylpropanoate
heptyl 4-hydroxybenzoate
Molecular structure of heptyl 4-hydroxybenzoate
4-heptyloxybenzoic acid
Molecular structure of 4-heptyloxybenzoic acid
2-(4-hexoxyphenyl)acetic acid
Molecular structure of 2-(4-hexoxyphenyl)acetic acid
  ::